C18H14FN7O2 — CID 170649781
2-N-(2H-benzotriazol-5-yl)-6-N-[(4-fluorophenyl)methyl]-3-nitropyridine-2,6-diamine (PubChem CID 170649781) has the molecular formula C18H14FN7O2 and a molecular weight of 379.36 g/mol. Its IUPAC name is 2-N-(2H-benzotriazol-5-yl)-6-N-[(4-fluorophenyl)methyl]-3-nitropyridine-2,6-diamine.
| Compound Name | 2-N-(2H-benzotriazol-5-yl)-6-N-[(4-fluorophenyl)methyl]-3-nitropyridine-2,6-diamine |
|---|---|
| PubChem CID | 170649781 |
| Molecular Formula | C18H14FN7O2 |
| Molecular Weight | 379.36 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | 2-N-(2H-benzotriazol-5-yl)-6-N-[(4-fluorophenyl)methyl]-3-nitropyridine-2,6-diamine |
| SMILES | O=[N+]([O-])c1ccc(NCc2ccc(F)cc2)nc1Nc1ccc2n[nH]nc2c1 |
| InChI | InChI=1S/C18H14FN7O2/c19-12-3-1-11(2-4-12)10-20-17-8-7-16(26(27)28)18(22-17)21-13-5-6-14-15(9-13)24-25-23-14/h1-9H,10H2,(H2,20,21,22)(H,23,24,25) |
| InChIKey | PLZVCYYWVUTFIH-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 121.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.36 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|