C20H22N8O4S2 — CID 170649742
5-[[6-(benzylamino)-3-(dimethylsulfamoylsulfonylamino)-2-pyridinyl]amino]-2H-benzotriazole (PubChem CID 170649742) has the molecular formula C20H22N8O4S2 and a molecular weight of 502.58 g/mol. Its IUPAC name is 5-[[6-(benzylamino)-3-(dimethylsulfamoylsulfonylamino)-2-pyridinyl]amino]-2H-benzotriazole.
| Compound Name | 5-[[6-(benzylamino)-3-(dimethylsulfamoylsulfonylamino)-2-pyridinyl]amino]-2H-benzotriazole |
|---|---|
| PubChem CID | 170649742 |
| Molecular Formula | C20H22N8O4S2 |
| Molecular Weight | 502.58 g/mol |
| Exact Mass | 502.12 |
| IUPAC Name | 5-[[6-(benzylamino)-3-(dimethylsulfamoylsulfonylamino)-2-pyridinyl]amino]-2H-benzotriazole |
| SMILES | CN(C)S(=O)(=O)S(=O)(=O)Nc1ccc(NCc2ccccc2)nc1Nc1ccc2n[nH]nc2c1 |
| InChI | InChI=1S/C20H22N8O4S2/c1-28(2)34(31,32)33(29,30)26-17-10-11-19(21-13-14-6-4-3-5-7-14)23-20(17)22-15-8-9-16-18(12-15)25-27-24-16/h3-12,26H,13H2,1-2H3,(H2,21,22,23)(H,24,25,27) |
| InChIKey | AURDDLBPHRBRIL-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 162.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.58 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|