C17H17N9O2 — CID 142703260
2-N-(2H-benzotriazol-5-yl)-6-N-(3-imidazol-1-ylpropyl)-3-nitropyridine-2,6-diamine (PubChem CID 142703260) has the molecular formula C17H17N9O2 and a molecular weight of 379.38 g/mol. Its IUPAC name is 2-N-(2H-benzotriazol-5-yl)-6-N-(3-imidazol-1-ylpropyl)-3-nitropyridine-2,6-diamine.
| Compound Name | 2-N-(2H-benzotriazol-5-yl)-6-N-(3-imidazol-1-ylpropyl)-3-nitropyridine-2,6-diamine |
|---|---|
| PubChem CID | 142703260 |
| Molecular Formula | C17H17N9O2 |
| Molecular Weight | 379.38 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 2-N-(2H-benzotriazol-5-yl)-6-N-(3-imidazol-1-ylpropyl)-3-nitropyridine-2,6-diamine |
| SMILES | O=[N+]([O-])c1ccc(NCCCn2ccnc2)nc1Nc1ccc2n[nH]nc2c1 |
| InChI | InChI=1S/C17H17N9O2/c27-26(28)15-4-5-16(19-6-1-8-25-9-7-18-11-25)21-17(15)20-12-2-3-13-14(10-12)23-24-22-13/h2-5,7,9-11H,1,6,8H2,(H2,19,20,21)(H,22,23,24) |
| InChIKey | QRNJUWFTNSHEIL-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 139.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.38 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|