C21H25N7O3 — CID 123232527
6-N-(3-imidazol-1-ylpropyl)-2-N-morpholin-4-yl-3-nitro-2-N-phenylpyridine-2,6-diamine (PubChem CID 123232527) has the molecular formula C21H25N7O3 and a molecular weight of 423.48 g/mol. Its IUPAC name is 6-N-(3-imidazol-1-ylpropyl)-2-N-morpholin-4-yl-3-nitro-2-N-phenylpyridine-2,6-diamine.
| Compound Name | 6-N-(3-imidazol-1-ylpropyl)-2-N-morpholin-4-yl-3-nitro-2-N-phenylpyridine-2,6-diamine |
|---|---|
| PubChem CID | 123232527 |
| Molecular Formula | C21H25N7O3 |
| Molecular Weight | 423.48 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | 6-N-(3-imidazol-1-ylpropyl)-2-N-morpholin-4-yl-3-nitro-2-N-phenylpyridine-2,6-diamine |
| SMILES | O=[N+]([O-])c1ccc(NCCCn2ccnc2)nc1N(c1ccccc1)N1CCOCC1 |
| InChI | InChI=1S/C21H25N7O3/c29-28(30)19-7-8-20(23-9-4-11-25-12-10-22-17-25)24-21(19)27(18-5-2-1-3-6-18)26-13-15-31-16-14-26/h1-3,5-8,10,12,17H,4,9,11,13-16H2,(H,23,24) |
| InChIKey | QYXVKEIEIAGBLW-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 101.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.48 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|