C13H12F3N5O4 — CID 2804808
N-(3-imidazol-1-ylpropyl)-2,6-dinitro-4-(trifluoromethyl)aniline (PubChem CID 2804808) has the molecular formula C13H12F3N5O4 and a molecular weight of 359.26 g/mol. Its IUPAC name is N-(3-imidazol-1-ylpropyl)-2,6-dinitro-4-(trifluoromethyl)aniline.
| Compound Name | N-(3-imidazol-1-ylpropyl)-2,6-dinitro-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 2804808 |
| Molecular Formula | C13H12F3N5O4 |
| Molecular Weight | 359.26 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | N-(3-imidazol-1-ylpropyl)-2,6-dinitro-4-(trifluoromethyl)aniline |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)cc([N+](=O)[O-])c1NCCCn1ccnc1 |
| InChI | InChI=1S/C13H12F3N5O4/c14-13(15,16)9-6-10(20(22)23)12(11(7-9)21(24)25)18-2-1-4-19-5-3-17-8-19/h3,5-8,18H,1-2,4H2 |
| InChIKey | UDYXJSRADBLKFS-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 116.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.26 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|