C11H9F3N3O6- — CID 4738133
4-[2,6-dinitro-4-(trifluoromethyl)anilino]butanoate (PubChem CID 4738133) has the molecular formula C11H9F3N3O6- and a molecular weight of 336.20 g/mol. Its IUPAC name is 4-[2,6-dinitro-4-(trifluoromethyl)anilino]butanoate.
| Compound Name | 4-[2,6-dinitro-4-(trifluoromethyl)anilino]butanoate |
|---|---|
| PubChem CID | 4738133 |
| Molecular Formula | C11H9F3N3O6- |
| Molecular Weight | 336.20 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | 4-[2,6-dinitro-4-(trifluoromethyl)anilino]butanoate |
| SMILES | O=C([O-])CCCNc1c([N+](=O)[O-])cc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H10F3N3O6/c12-11(13,14)6-4-7(16(20)21)10(8(5-6)17(22)23)15-3-1-2-9(18)19/h4-5,15H,1-3H2,(H,18,19)/p-1 |
| InChIKey | ZBQGZSQEIRVUIW-UHFFFAOYSA-M |
| XLogP | 1.46 |
| TPSA | 138.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.20 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|