C10H12N3O4- — CID 5276888
4-(3-amino-4-nitroanilino)butanoate (PubChem CID 5276888) has the molecular formula C10H12N3O4- and a molecular weight of 238.22 g/mol. Its IUPAC name is 4-(3-amino-4-nitroanilino)butanoate.
| Compound Name | 4-(3-amino-4-nitroanilino)butanoate |
|---|---|
| PubChem CID | 5276888 |
| Molecular Formula | C10H12N3O4- |
| Molecular Weight | 238.22 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 4-(3-amino-4-nitroanilino)butanoate |
| SMILES | Nc1cc(NCCCC(=O)[O-])ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H13N3O4/c11-8-6-7(3-4-9(8)13(16)17)12-5-1-2-10(14)15/h3-4,6,12H,1-2,5,11H2,(H,14,15)/p-1 |
| InChIKey | BSYFYFNFJAQSEL-UHFFFAOYSA-M |
| XLogP | 0.12 |
| TPSA | 121.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.22 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|