C14H15F3N4O6 — CID 133430613
4-[[2,6-dinitro-4-(trifluoromethyl)anilino]methyl]oxane-4-carboxamide (PubChem CID 133430613) has the molecular formula C14H15F3N4O6 and a molecular weight of 392.29 g/mol. Its IUPAC name is 4-[[2,6-dinitro-4-(trifluoromethyl)anilino]methyl]oxane-4-carboxamide.
| Compound Name | 4-[[2,6-dinitro-4-(trifluoromethyl)anilino]methyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 133430613 |
| Molecular Formula | C14H15F3N4O6 |
| Molecular Weight | 392.29 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | 4-[[2,6-dinitro-4-(trifluoromethyl)anilino]methyl]oxane-4-carboxamide |
| SMILES | NC(=O)C1(CNc2c([N+](=O)[O-])cc(C(F)(F)F)cc2[N+](=O)[O-])CCOCC1 |
| InChI | InChI=1S/C14H15F3N4O6/c15-14(16,17)8-5-9(20(23)24)11(10(6-8)21(25)26)19-7-13(12(18)22)1-3-27-4-2-13/h5-6,19H,1-4,7H2,(H2,18,22) |
| InChIKey | RZVZZWZWDJJYAC-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 150.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.29 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|