C12H14F3N3O5 — CID 53423501
2-[3-[2,6-dinitro-4-(trifluoromethyl)phenyl]propylamino]ethanol (PubChem CID 53423501) has the molecular formula C12H14F3N3O5 and a molecular weight of 337.25 g/mol. Its IUPAC name is 2-[3-[2,6-dinitro-4-(trifluoromethyl)phenyl]propylamino]ethanol.
| Compound Name | 2-[3-[2,6-dinitro-4-(trifluoromethyl)phenyl]propylamino]ethanol |
|---|---|
| PubChem CID | 53423501 |
| Molecular Formula | C12H14F3N3O5 |
| Molecular Weight | 337.25 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | 2-[3-[2,6-dinitro-4-(trifluoromethyl)phenyl]propylamino]ethanol |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)cc([N+](=O)[O-])c1CCCNCCO |
| InChI | InChI=1S/C12H14F3N3O5/c13-12(14,15)8-6-10(17(20)21)9(11(7-8)18(22)23)2-1-3-16-4-5-19/h6-7,16,19H,1-5H2 |
| InChIKey | RTDJMISZJQUKMB-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 118.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.25 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|