C13H17F3N4O5 — CID 57109459
1-[3-[3-amino-2,6-dinitro-4-(trifluoromethyl)phenyl]propylamino]propan-2-ol (PubChem CID 57109459) has the molecular formula C13H17F3N4O5 and a molecular weight of 366.30 g/mol. Its IUPAC name is 1-[3-[3-amino-2,6-dinitro-4-(trifluoromethyl)phenyl]propylamino]propan-2-ol.
| Compound Name | 1-[3-[3-amino-2,6-dinitro-4-(trifluoromethyl)phenyl]propylamino]propan-2-ol |
|---|---|
| PubChem CID | 57109459 |
| Molecular Formula | C13H17F3N4O5 |
| Molecular Weight | 366.30 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 1-[3-[3-amino-2,6-dinitro-4-(trifluoromethyl)phenyl]propylamino]propan-2-ol |
| SMILES | CC(O)CNCCCc1c([N+](=O)[O-])cc(C(F)(F)F)c(N)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H17F3N4O5/c1-7(21)6-18-4-2-3-8-10(19(22)23)5-9(13(14,15)16)11(17)12(8)20(24)25/h5,7,18,21H,2-4,6,17H2,1H3 |
| InChIKey | QYYYMEYXBRJTMK-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 144.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.30 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|