C11H15F2N3O3 — CID 104594423
1-[2-(3,5-difluoro-2-nitroanilino)ethylamino]propan-2-ol (PubChem CID 104594423) has the molecular formula C11H15F2N3O3 and a molecular weight of 275.25 g/mol. Its IUPAC name is 1-[2-(3,5-difluoro-2-nitroanilino)ethylamino]propan-2-ol.
| Compound Name | 1-[2-(3,5-difluoro-2-nitroanilino)ethylamino]propan-2-ol |
|---|---|
| PubChem CID | 104594423 |
| Molecular Formula | C11H15F2N3O3 |
| Molecular Weight | 275.25 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 1-[2-(3,5-difluoro-2-nitroanilino)ethylamino]propan-2-ol |
| SMILES | CC(O)CNCCNc1cc(F)cc(F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H15F2N3O3/c1-7(17)6-14-2-3-15-10-5-8(12)4-9(13)11(10)16(18)19/h4-5,7,14-15,17H,2-3,6H2,1H3 |
| InChIKey | PUCQZTJGRCKDMS-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 87.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.25 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|