C13H18F2N2O2 — CID 83144735
3,5-difluoro-2-nitro-N-(2,3,3-trimethylbutyl)aniline (PubChem CID 83144735) has the molecular formula C13H18F2N2O2 and a molecular weight of 272.29 g/mol. Its IUPAC name is 3,5-difluoro-2-nitro-N-(2,3,3-trimethylbutyl)aniline.
| Compound Name | 3,5-difluoro-2-nitro-N-(2,3,3-trimethylbutyl)aniline |
|---|---|
| PubChem CID | 83144735 |
| Molecular Formula | C13H18F2N2O2 |
| Molecular Weight | 272.29 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 3,5-difluoro-2-nitro-N-(2,3,3-trimethylbutyl)aniline |
| SMILES | CC(CNc1cc(F)cc(F)c1[N+](=O)[O-])C(C)(C)C |
| InChI | InChI=1S/C13H18F2N2O2/c1-8(13(2,3)4)7-16-11-6-9(14)5-10(15)12(11)17(18)19/h5-6,8,16H,7H2,1-4H3 |
| InChIKey | VXRMNJNSUKLDKD-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.29 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|