C9H11F2N3O2 — CID 115509740
2-N-(3,5-difluoro-2-nitrophenyl)propane-1,2-diamine (PubChem CID 115509740) has the molecular formula C9H11F2N3O2 and a molecular weight of 231.20 g/mol. Its IUPAC name is 2-N-(3,5-difluoro-2-nitrophenyl)propane-1,2-diamine.
| Compound Name | 2-N-(3,5-difluoro-2-nitrophenyl)propane-1,2-diamine |
|---|---|
| PubChem CID | 115509740 |
| Molecular Formula | C9H11F2N3O2 |
| Molecular Weight | 231.20 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | 2-N-(3,5-difluoro-2-nitrophenyl)propane-1,2-diamine |
| SMILES | CC(CN)Nc1cc(F)cc(F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H11F2N3O2/c1-5(4-12)13-8-3-6(10)2-7(11)9(8)14(15)16/h2-3,5,13H,4,12H2,1H3 |
| InChIKey | QRGTTZALAHITKC-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.20 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|