C8H9F2N3O4S — CID 115507734
2-(3,5-difluoro-2-nitroanilino)ethanesulfonamide (PubChem CID 115507734) has the molecular formula C8H9F2N3O4S and a molecular weight of 281.24 g/mol. Its IUPAC name is 2-(3,5-difluoro-2-nitroanilino)ethanesulfonamide.
| Compound Name | 2-(3,5-difluoro-2-nitroanilino)ethanesulfonamide |
|---|---|
| PubChem CID | 115507734 |
| Molecular Formula | C8H9F2N3O4S |
| Molecular Weight | 281.24 g/mol |
| Exact Mass | 281.03 |
| IUPAC Name | 2-(3,5-difluoro-2-nitroanilino)ethanesulfonamide |
| SMILES | NS(=O)(=O)CCNc1cc(F)cc(F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C8H9F2N3O4S/c9-5-3-6(10)8(13(14)15)7(4-5)12-1-2-18(11,16)17/h3-4,12H,1-2H2,(H2,11,16,17) |
| InChIKey | GYYBWOJLCWDJJB-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.24 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|