C14H10F3N3O5 — CID 19425998
[2-[2,6-dinitro-4-(trifluoromethyl)anilino]phenyl]methanol (PubChem CID 19425998) has the molecular formula C14H10F3N3O5 and a molecular weight of 357.24 g/mol. Its IUPAC name is [2-[2,6-dinitro-4-(trifluoromethyl)anilino]phenyl]methanol.
| Compound Name | [2-[2,6-dinitro-4-(trifluoromethyl)anilino]phenyl]methanol |
|---|---|
| PubChem CID | 19425998 |
| Molecular Formula | C14H10F3N3O5 |
| Molecular Weight | 357.24 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | [2-[2,6-dinitro-4-(trifluoromethyl)anilino]phenyl]methanol |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)cc([N+](=O)[O-])c1Nc1ccccc1CO |
| InChI | InChI=1S/C14H10F3N3O5/c15-14(16,17)9-5-11(19(22)23)13(12(6-9)20(24)25)18-10-4-2-1-3-8(10)7-21/h1-6,18,21H,7H2 |
| InChIKey | XVSFMUTUGRQPIM-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 118.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.24 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|