C14H7F6N3O5S — CID 4093632
2,6-dinitro-4-(trifluoromethyl)-N-[4-(trifluoromethylsulfinyl)phenyl]aniline (PubChem CID 4093632) has the molecular formula C14H7F6N3O5S and a molecular weight of 443.28 g/mol. Its IUPAC name is 2,6-dinitro-4-(trifluoromethyl)-N-[4-(trifluoromethylsulfinyl)phenyl]aniline.
| Compound Name | 2,6-dinitro-4-(trifluoromethyl)-N-[4-(trifluoromethylsulfinyl)phenyl]aniline |
|---|---|
| PubChem CID | 4093632 |
| Molecular Formula | C14H7F6N3O5S |
| Molecular Weight | 443.28 g/mol |
| Exact Mass | 443.00 |
| IUPAC Name | 2,6-dinitro-4-(trifluoromethyl)-N-[4-(trifluoromethylsulfinyl)phenyl]aniline |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)cc([N+](=O)[O-])c1Nc1ccc(S(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H7F6N3O5S/c15-13(16,17)7-5-10(22(24)25)12(11(6-7)23(26)27)21-8-1-3-9(4-2-8)29(28)14(18,19)20/h1-6,21H |
| InChIKey | KIZSQALUUPTZIN-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 115.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.28 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|