C16H12F3N3O4 — CID 162540890
N-[2,6-dinitro-4-(trifluoromethyl)phenyl]-2,3-dihydro-1H-inden-5-amine (PubChem CID 162540890) has the molecular formula C16H12F3N3O4 and a molecular weight of 367.28 g/mol. Its IUPAC name is N-[2,6-dinitro-4-(trifluoromethyl)phenyl]-2,3-dihydro-1H-inden-5-amine.
| Compound Name | N-[2,6-dinitro-4-(trifluoromethyl)phenyl]-2,3-dihydro-1H-inden-5-amine |
|---|---|
| PubChem CID | 162540890 |
| Molecular Formula | C16H12F3N3O4 |
| Molecular Weight | 367.28 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | N-[2,6-dinitro-4-(trifluoromethyl)phenyl]-2,3-dihydro-1H-inden-5-amine |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)cc([N+](=O)[O-])c1Nc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C16H12F3N3O4/c17-16(18,19)11-7-13(21(23)24)15(14(8-11)22(25)26)20-12-5-4-9-2-1-3-10(9)6-12/h4-8,20H,1-3H2 |
| InChIKey | ADTMJNOTTZJZSM-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.28 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|