C13H9F3N4O4 — CID 25356872
N-[2,6-dinitro-4-(trifluoromethyl)phenyl]-5-methylpyridin-2-amine (PubChem CID 25356872) has the molecular formula C13H9F3N4O4 and a molecular weight of 342.23 g/mol. Its IUPAC name is N-[2,6-dinitro-4-(trifluoromethyl)phenyl]-5-methylpyridin-2-amine.
| Compound Name | N-[2,6-dinitro-4-(trifluoromethyl)phenyl]-5-methylpyridin-2-amine |
|---|---|
| PubChem CID | 25356872 |
| Molecular Formula | C13H9F3N4O4 |
| Molecular Weight | 342.23 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | N-[2,6-dinitro-4-(trifluoromethyl)phenyl]-5-methylpyridin-2-amine |
| SMILES | Cc1ccc(Nc2c([N+](=O)[O-])cc(C(F)(F)F)cc2[N+](=O)[O-])nc1 |
| InChI | InChI=1S/C13H9F3N4O4/c1-7-2-3-11(17-6-7)18-12-9(19(21)22)4-8(13(14,15)16)5-10(12)20(23)24/h2-6H,1H3,(H,17,18) |
| InChIKey | SGDARRYOFYZDIQ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 111.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.23 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|