C15H10F6N2O — CID 43016681
N-(5-methyl-2-pyridinyl)-3,5-bis(trifluoromethyl)benzamide (PubChem CID 43016681) has the molecular formula C15H10F6N2O and a molecular weight of 348.25 g/mol. Its IUPAC name is N-(5-methyl-2-pyridinyl)-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-(5-methyl-2-pyridinyl)-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 43016681 |
| Molecular Formula | C15H10F6N2O |
| Molecular Weight | 348.25 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | N-(5-methyl-2-pyridinyl)-3,5-bis(trifluoromethyl)benzamide |
| SMILES | Cc1ccc(NC(=O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)nc1 |
| InChI | InChI=1S/C15H10F6N2O/c1-8-2-3-12(22-7-8)23-13(24)9-4-10(14(16,17)18)6-11(5-9)15(19,20)21/h2-7H,1H3,(H,22,23,24) |
| InChIKey | BXIZRXMMONGWET-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.25 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |