C15H5Cl2F8N3O5 — CID 88773226
2,4-dichloro-N-[2,6-dinitro-4-(trifluoromethyl)phenyl]-3-(1,1,2,2,2-pentafluoroethoxy)aniline (PubChem CID 88773226) has the molecular formula C15H5Cl2F8N3O5 and a molecular weight of 530.11 g/mol. Its IUPAC name is 2,4-dichloro-N-[2,6-dinitro-4-(trifluoromethyl)phenyl]-3-(1,1,2,2,2-pentafluoroethoxy)aniline.
| Compound Name | 2,4-dichloro-N-[2,6-dinitro-4-(trifluoromethyl)phenyl]-3-(1,1,2,2,2-pentafluoroethoxy)aniline |
|---|---|
| PubChem CID | 88773226 |
| Molecular Formula | C15H5Cl2F8N3O5 |
| Molecular Weight | 530.11 g/mol |
| Exact Mass | 528.95 |
| IUPAC Name | 2,4-dichloro-N-[2,6-dinitro-4-(trifluoromethyl)phenyl]-3-(1,1,2,2,2-pentafluoroethoxy)aniline |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)cc([N+](=O)[O-])c1Nc1ccc(Cl)c(OC(F)(F)C(F)(F)F)c1Cl |
| InChI | InChI=1S/C15H5Cl2F8N3O5/c16-6-1-2-7(10(17)12(6)33-15(24,25)14(21,22)23)26-11-8(27(29)30)3-5(13(18,19)20)4-9(11)28(31)32/h1-4,26H |
| InChIKey | FJUINVGKCDYMEO-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 107.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.11 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|