C15H8F7N3O5 — CID 12807402
2,6-dinitro-N-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]-4-(trifluoromethyl)aniline (PubChem CID 12807402) has the molecular formula C15H8F7N3O5 and a molecular weight of 443.23 g/mol. Its IUPAC name is 2,6-dinitro-N-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]-4-(trifluoromethyl)aniline.
| Compound Name | 2,6-dinitro-N-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 12807402 |
| Molecular Formula | C15H8F7N3O5 |
| Molecular Weight | 443.23 g/mol |
| Exact Mass | 443.04 |
| IUPAC Name | 2,6-dinitro-N-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]-4-(trifluoromethyl)aniline |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)cc([N+](=O)[O-])c1Nc1ccccc1OC(F)(F)C(F)F |
| InChI | InChI=1S/C15H8F7N3O5/c16-13(17)15(21,22)30-11-4-2-1-3-8(11)23-12-9(24(26)27)5-7(14(18,19)20)6-10(12)25(28)29/h1-6,13,23H |
| InChIKey | SDAPUHKEIUYJOI-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 107.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.23 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|