C12H7FN4O6 — CID 3312335
N-(2-fluorophenyl)-2,4,6-trinitroaniline (PubChem CID 3312335) has the molecular formula C12H7FN4O6 and a molecular weight of 322.21 g/mol. Its IUPAC name is N-(2-fluorophenyl)-2,4,6-trinitroaniline.
| Compound Name | N-(2-fluorophenyl)-2,4,6-trinitroaniline |
|---|---|
| PubChem CID | 3312335 |
| Molecular Formula | C12H7FN4O6 |
| Molecular Weight | 322.21 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | N-(2-fluorophenyl)-2,4,6-trinitroaniline |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(Nc2ccccc2F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H7FN4O6/c13-8-3-1-2-4-9(8)14-12-10(16(20)21)5-7(15(18)19)6-11(12)17(22)23/h1-6,14H |
| InChIKey | ICPWCBARTQWDKC-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 141.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.21 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|