C14H12N4O8 — CID 4610766
N-(2,5-dimethoxyphenyl)-2,4,6-trinitroaniline (PubChem CID 4610766) has the molecular formula C14H12N4O8 and a molecular weight of 364.27 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-2,4,6-trinitroaniline.
| Compound Name | N-(2,5-dimethoxyphenyl)-2,4,6-trinitroaniline |
|---|---|
| PubChem CID | 4610766 |
| Molecular Formula | C14H12N4O8 |
| Molecular Weight | 364.27 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-2,4,6-trinitroaniline |
| SMILES | COc1ccc(OC)c(Nc2c([N+](=O)[O-])cc([N+](=O)[O-])cc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H12N4O8/c1-25-9-3-4-13(26-2)10(7-9)15-14-11(17(21)22)5-8(16(19)20)6-12(14)18(23)24/h3-7,15H,1-2H3 |
| InChIKey | MXIKOOWWETVPGL-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 159.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.27 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|