C16H13ClF3N5O7 — CID 3119339
1-(2-chloro-4-nitroanilino)-3-[2,6-dinitro-4-(trifluoromethyl)anilino]propan-2-ol (PubChem CID 3119339) has the molecular formula C16H13ClF3N5O7 and a molecular weight of 479.76 g/mol. Its IUPAC name is 1-(2-chloro-4-nitroanilino)-3-[2,6-dinitro-4-(trifluoromethyl)anilino]propan-2-ol.
| Compound Name | 1-(2-chloro-4-nitroanilino)-3-[2,6-dinitro-4-(trifluoromethyl)anilino]propan-2-ol |
|---|---|
| PubChem CID | 3119339 |
| Molecular Formula | C16H13ClF3N5O7 |
| Molecular Weight | 479.76 g/mol |
| Exact Mass | 479.05 |
| IUPAC Name | 1-(2-chloro-4-nitroanilino)-3-[2,6-dinitro-4-(trifluoromethyl)anilino]propan-2-ol |
| SMILES | O=[N+]([O-])c1ccc(NCC(O)CNc2c([N+](=O)[O-])cc(C(F)(F)F)cc2[N+](=O)[O-])c(Cl)c1 |
| InChI | InChI=1S/C16H13ClF3N5O7/c17-11-5-9(23(27)28)1-2-12(11)21-6-10(26)7-22-15-13(24(29)30)3-8(16(18,19)20)4-14(15)25(31)32/h1-5,10,21-22,26H,6-7H2 |
| InChIKey | HWJKKIADPFMTDV-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 173.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.76 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|