C15H17N5 — CID 154338498
N-(3-imidazol-1-ylpropyl)-5-methyl-1,6-naphthyridin-2-amine (PubChem CID 154338498) has the molecular formula C15H17N5 and a molecular weight of 267.34 g/mol. Its IUPAC name is N-(3-imidazol-1-ylpropyl)-5-methyl-1,6-naphthyridin-2-amine.
| Compound Name | N-(3-imidazol-1-ylpropyl)-5-methyl-1,6-naphthyridin-2-amine |
|---|---|
| PubChem CID | 154338498 |
| Molecular Formula | C15H17N5 |
| Molecular Weight | 267.34 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | N-(3-imidazol-1-ylpropyl)-5-methyl-1,6-naphthyridin-2-amine |
| SMILES | Cc1nccc2nc(NCCCn3ccnc3)ccc12 |
| InChI | InChI=1S/C15H17N5/c1-12-13-3-4-15(19-14(13)5-7-17-12)18-6-2-9-20-10-8-16-11-20/h3-5,7-8,10-11H,2,6,9H2,1H3,(H,18,19) |
| InChIKey | NITZRDIWVHXXOM-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.34 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|