C11H13FN4 — CID 61313733
5-fluoro-N-(3-imidazol-1-ylpropyl)pyridin-2-amine (PubChem CID 61313733) has the molecular formula C11H13FN4 and a molecular weight of 220.25 g/mol. Its IUPAC name is 5-fluoro-N-(3-imidazol-1-ylpropyl)pyridin-2-amine.
| Compound Name | 5-fluoro-N-(3-imidazol-1-ylpropyl)pyridin-2-amine |
|---|---|
| PubChem CID | 61313733 |
| Molecular Formula | C11H13FN4 |
| Molecular Weight | 220.25 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | 5-fluoro-N-(3-imidazol-1-ylpropyl)pyridin-2-amine |
| SMILES | Fc1ccc(NCCCn2ccnc2)nc1 |
| InChI | InChI=1S/C11H13FN4/c12-10-2-3-11(15-8-10)14-4-1-6-16-7-5-13-9-16/h2-3,5,7-9H,1,4,6H2,(H,14,15) |
| InChIKey | DXRODEKTZCPRIY-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.25 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|