C20H19FN6O — CID 29021727
5-[3-[(4-fluorophenyl)methyl]-1,2,4-oxadiazol-5-yl]-N-(3-imidazol-1-ylpropyl)pyridin-2-amine (PubChem CID 29021727) has the molecular formula C20H19FN6O and a molecular weight of 378.41 g/mol. Its IUPAC name is 5-[3-[(4-fluorophenyl)methyl]-1,2,4-oxadiazol-5-yl]-N-(3-imidazol-1-ylpropyl)pyridin-2-amine.
| Compound Name | 5-[3-[(4-fluorophenyl)methyl]-1,2,4-oxadiazol-5-yl]-N-(3-imidazol-1-ylpropyl)pyridin-2-amine |
|---|---|
| PubChem CID | 29021727 |
| Molecular Formula | C20H19FN6O |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 5-[3-[(4-fluorophenyl)methyl]-1,2,4-oxadiazol-5-yl]-N-(3-imidazol-1-ylpropyl)pyridin-2-amine |
| SMILES | Fc1ccc(Cc2noc(-c3ccc(NCCCn4ccnc4)nc3)n2)cc1 |
| InChI | InChI=1S/C20H19FN6O/c21-17-5-2-15(3-6-17)12-19-25-20(28-26-19)16-4-7-18(24-13-16)23-8-1-10-27-11-9-22-14-27/h2-7,9,11,13-14H,1,8,10,12H2,(H,23,24) |
| InChIKey | AHABPESEGIMFSZ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 81.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|