C21H18N6O2S — CID 67995901
2-N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]-3-nitro-6-N-(pyridin-4-ylmethyl)pyridine-2,6-diamine (PubChem CID 67995901) has the molecular formula C21H18N6O2S and a molecular weight of 418.48 g/mol. Its IUPAC name is 2-N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]-3-nitro-6-N-(pyridin-4-ylmethyl)pyridine-2,6-diamine.
| Compound Name | 2-N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]-3-nitro-6-N-(pyridin-4-ylmethyl)pyridine-2,6-diamine |
|---|---|
| PubChem CID | 67995901 |
| Molecular Formula | C21H18N6O2S |
| Molecular Weight | 418.48 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | 2-N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]-3-nitro-6-N-(pyridin-4-ylmethyl)pyridine-2,6-diamine |
| SMILES | Cc1nc(-c2ccc(Nc3nc(NCc4ccncc4)ccc3[N+](=O)[O-])cc2)cs1 |
| InChI | InChI=1S/C21H18N6O2S/c1-14-24-18(13-30-14)16-2-4-17(5-3-16)25-21-19(27(28)29)6-7-20(26-21)23-12-15-8-10-22-11-9-15/h2-11,13H,12H2,1H3,(H2,23,25,26) |
| InChIKey | DQEGVBPWILXBJK-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 105.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.48 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|