C10H8Br2N2O2S — CID 2776589
4-(4-bromo-3-nitrophenyl)-2-methyl-1,3-thiazole;hydrobromide (PubChem CID 2776589) has the molecular formula C10H8Br2N2O2S and a molecular weight of 380.06 g/mol. Its IUPAC name is 4-(4-bromo-3-nitrophenyl)-2-methyl-1,3-thiazole;hydrobromide.
| Compound Name | 4-(4-bromo-3-nitrophenyl)-2-methyl-1,3-thiazole;hydrobromide |
|---|---|
| PubChem CID | 2776589 |
| Molecular Formula | C10H8Br2N2O2S |
| Molecular Weight | 380.06 g/mol |
| Exact Mass | 377.87 |
| IUPAC Name | 4-(4-bromo-3-nitrophenyl)-2-methyl-1,3-thiazole;hydrobromide |
| SMILES | Br.Cc1nc(-c2ccc(Br)c([N+](=O)[O-])c2)cs1 |
| InChI | InChI=1S/C10H7BrN2O2S.BrH/c1-6-12-9(5-16-6)7-2-3-8(11)10(4-7)13(14)15;/h2-5H,1H3;1H |
| InChIKey | BZCACJNXYAKJNT-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.06 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|