C17H12N4O5S — CID 23764172
N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]-3,5-dinitrobenzamide (PubChem CID 23764172) has the molecular formula C17H12N4O5S and a molecular weight of 384.37 g/mol. Its IUPAC name is N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]-3,5-dinitrobenzamide.
| Compound Name | N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 23764172 |
| Molecular Formula | C17H12N4O5S |
| Molecular Weight | 384.37 g/mol |
| Exact Mass | 384.05 |
| IUPAC Name | N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]-3,5-dinitrobenzamide |
| SMILES | Cc1nc(-c2ccc(NC(=O)c3cc([N+](=O)[O-])cc([N+](=O)[O-])c3)cc2)cs1 |
| InChI | InChI=1S/C17H12N4O5S/c1-10-18-16(9-27-10)11-2-4-13(5-3-11)19-17(22)12-6-14(20(23)24)8-15(7-12)21(25)26/h2-9H,1H3,(H,19,22) |
| InChIKey | PSQFAYTXRBOBLE-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 128.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.37 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|