C23H15F3N4O3S — CID 16745797
N-[4-(2-anilino-1,3-thiazol-4-yl)phenyl]-3-nitro-5-(trifluoromethyl)benzamide (PubChem CID 16745797) has the molecular formula C23H15F3N4O3S and a molecular weight of 484.46 g/mol. Its IUPAC name is N-[4-(2-anilino-1,3-thiazol-4-yl)phenyl]-3-nitro-5-(trifluoromethyl)benzamide.
| Compound Name | N-[4-(2-anilino-1,3-thiazol-4-yl)phenyl]-3-nitro-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 16745797 |
| Molecular Formula | C23H15F3N4O3S |
| Molecular Weight | 484.46 g/mol |
| Exact Mass | 484.08 |
| IUPAC Name | N-[4-(2-anilino-1,3-thiazol-4-yl)phenyl]-3-nitro-5-(trifluoromethyl)benzamide |
| SMILES | O=C(Nc1ccc(-c2csc(Nc3ccccc3)n2)cc1)c1cc([N+](=O)[O-])cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H15F3N4O3S/c24-23(25,26)16-10-15(11-19(12-16)30(32)33)21(31)27-18-8-6-14(7-9-18)20-13-34-22(29-20)28-17-4-2-1-3-5-17/h1-13H,(H,27,31)(H,28,29) |
| InChIKey | XVXVKOFOZVWKAM-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 97.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.46 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|