C21H14N6O5S — CID 110492904
3,5-dinitro-N-[4-[(4-pyridin-4-yl-1,3-thiazol-2-yl)amino]phenyl]benzamide (PubChem CID 110492904) has the molecular formula C21H14N6O5S and a molecular weight of 462.45 g/mol. Its IUPAC name is 3,5-dinitro-N-[4-[(4-pyridin-4-yl-1,3-thiazol-2-yl)amino]phenyl]benzamide.
| Compound Name | 3,5-dinitro-N-[4-[(4-pyridin-4-yl-1,3-thiazol-2-yl)amino]phenyl]benzamide |
|---|---|
| PubChem CID | 110492904 |
| Molecular Formula | C21H14N6O5S |
| Molecular Weight | 462.45 g/mol |
| Exact Mass | 462.07 |
| IUPAC Name | 3,5-dinitro-N-[4-[(4-pyridin-4-yl-1,3-thiazol-2-yl)amino]phenyl]benzamide |
| SMILES | O=C(Nc1ccc(Nc2nc(-c3ccncc3)cs2)cc1)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H14N6O5S/c28-20(14-9-17(26(29)30)11-18(10-14)27(31)32)23-15-1-3-16(4-2-15)24-21-25-19(12-33-21)13-5-7-22-8-6-13/h1-12H,(H,23,28)(H,24,25) |
| InChIKey | FKDQZKHTLVONBS-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 153.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.45 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|