C15H10N3O2S- — CID 3513785
4-[(4-pyridin-4-yl-1,3-thiazol-2-yl)amino]benzoate (PubChem CID 3513785) has the molecular formula C15H10N3O2S- and a molecular weight of 296.33 g/mol. Its IUPAC name is 4-[(4-pyridin-4-yl-1,3-thiazol-2-yl)amino]benzoate.
| Compound Name | 4-[(4-pyridin-4-yl-1,3-thiazol-2-yl)amino]benzoate |
|---|---|
| PubChem CID | 3513785 |
| Molecular Formula | C15H10N3O2S- |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | 4-[(4-pyridin-4-yl-1,3-thiazol-2-yl)amino]benzoate |
| SMILES | O=C([O-])c1ccc(Nc2nc(-c3ccncc3)cs2)cc1 |
| InChI | InChI=1S/C15H11N3O2S/c19-14(20)11-1-3-12(4-2-11)17-15-18-13(9-21-15)10-5-7-16-8-6-10/h1-9H,(H,17,18)(H,19,20)/p-1 |
| InChIKey | WHRNHGVWRMJMTL-UHFFFAOYSA-M |
| XLogP | 2.31 |
| TPSA | 77.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |