C19H18N4OS — CID 110492935
3-methyl-N-[4-[(4-pyridin-4-yl-1,3-thiazol-2-yl)amino]phenyl]but-2-enamide (PubChem CID 110492935) has the molecular formula C19H18N4OS and a molecular weight of 350.45 g/mol. Its IUPAC name is 3-methyl-N-[4-[(4-pyridin-4-yl-1,3-thiazol-2-yl)amino]phenyl]but-2-enamide.
| Compound Name | 3-methyl-N-[4-[(4-pyridin-4-yl-1,3-thiazol-2-yl)amino]phenyl]but-2-enamide |
|---|---|
| PubChem CID | 110492935 |
| Molecular Formula | C19H18N4OS |
| Molecular Weight | 350.45 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 3-methyl-N-[4-[(4-pyridin-4-yl-1,3-thiazol-2-yl)amino]phenyl]but-2-enamide |
| SMILES | CC(C)=CC(=O)Nc1ccc(Nc2nc(-c3ccncc3)cs2)cc1 |
| InChI | InChI=1S/C19H18N4OS/c1-13(2)11-18(24)21-15-3-5-16(6-4-15)22-19-23-17(12-25-19)14-7-9-20-10-8-14/h3-12H,1-2H3,(H,21,24)(H,22,23) |
| InChIKey | GNAZSQUKKAQTOE-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.45 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|