C18H14N4O5S — CID 108727304
4-methyl-N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]-3,5-dinitrobenzamide (PubChem CID 108727304) has the molecular formula C18H14N4O5S and a molecular weight of 398.40 g/mol. Its IUPAC name is 4-methyl-N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]-3,5-dinitrobenzamide.
| Compound Name | 4-methyl-N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 108727304 |
| Molecular Formula | C18H14N4O5S |
| Molecular Weight | 398.40 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | 4-methyl-N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]-3,5-dinitrobenzamide |
| SMILES | Cc1nc(-c2ccc(NC(=O)c3cc([N+](=O)[O-])c(C)c([N+](=O)[O-])c3)cc2)cs1 |
| InChI | InChI=1S/C18H14N4O5S/c1-10-16(21(24)25)7-13(8-17(10)22(26)27)18(23)20-14-5-3-12(4-6-14)15-9-28-11(2)19-15/h3-9H,1-2H3,(H,20,23) |
| InChIKey | WMOYVQCDXCIMIN-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 128.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.40 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|