C10H8FN3O2S — CID 114059915
4-(4-fluoro-3-nitrophenyl)-N-methyl-1,3-thiazol-2-amine (PubChem CID 114059915) has the molecular formula C10H8FN3O2S and a molecular weight of 253.26 g/mol. Its IUPAC name is 4-(4-fluoro-3-nitrophenyl)-N-methyl-1,3-thiazol-2-amine.
| Compound Name | 4-(4-fluoro-3-nitrophenyl)-N-methyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 114059915 |
| Molecular Formula | C10H8FN3O2S |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.03 |
| IUPAC Name | 4-(4-fluoro-3-nitrophenyl)-N-methyl-1,3-thiazol-2-amine |
| SMILES | CNc1nc(-c2ccc(F)c([N+](=O)[O-])c2)cs1 |
| InChI | InChI=1S/C10H8FN3O2S/c1-12-10-13-8(5-17-10)6-2-3-7(11)9(4-6)14(15)16/h2-5H,1H3,(H,12,13) |
| InChIKey | MCNSWYKRGQGPLG-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|