C21H16FN5O6S — CID 55536307
1-(4-fluoro-3-nitrophenyl)-N-[4-(4-methyl-3-nitrophenyl)-1,3-thiazol-2-yl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 55536307) has the molecular formula C21H16FN5O6S and a molecular weight of 485.45 g/mol. Its IUPAC name is 1-(4-fluoro-3-nitrophenyl)-N-[4-(4-methyl-3-nitrophenyl)-1,3-thiazol-2-yl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-(4-fluoro-3-nitrophenyl)-N-[4-(4-methyl-3-nitrophenyl)-1,3-thiazol-2-yl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 55536307 |
| Molecular Formula | C21H16FN5O6S |
| Molecular Weight | 485.45 g/mol |
| Exact Mass | 485.08 |
| IUPAC Name | 1-(4-fluoro-3-nitrophenyl)-N-[4-(4-methyl-3-nitrophenyl)-1,3-thiazol-2-yl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | Cc1ccc(-c2csc(NC(=O)C3CC(=O)N(c4ccc(F)c([N+](=O)[O-])c4)C3)n2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H16FN5O6S/c1-11-2-3-12(6-17(11)26(30)31)16-10-34-21(23-16)24-20(29)13-7-19(28)25(9-13)14-4-5-15(22)18(8-14)27(32)33/h2-6,8,10,13H,7,9H2,1H3,(H,23,24,29) |
| InChIKey | ABAVRYPYNJBPTA-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 148.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.45 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|