C23H20N4O6S — CID 55468721
1-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[4-(4-methyl-3-nitrophenyl)-1,3-thiazol-2-yl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 55468721) has the molecular formula C23H20N4O6S and a molecular weight of 480.50 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[4-(4-methyl-3-nitrophenyl)-1,3-thiazol-2-yl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[4-(4-methyl-3-nitrophenyl)-1,3-thiazol-2-yl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 55468721 |
| Molecular Formula | C23H20N4O6S |
| Molecular Weight | 480.50 g/mol |
| Exact Mass | 480.11 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[4-(4-methyl-3-nitrophenyl)-1,3-thiazol-2-yl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | Cc1ccc(-c2csc(NC(=O)C3CC(=O)N(c4ccc5c(c4)OCCO5)C3)n2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H20N4O6S/c1-13-2-3-14(8-18(13)27(30)31)17-12-34-23(24-17)25-22(29)15-9-21(28)26(11-15)16-4-5-19-20(10-16)33-7-6-32-19/h2-5,8,10,12,15H,6-7,9,11H2,1H3,(H,24,25,29) |
| InChIKey | QBPKCTOXVVTNIW-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 123.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.50 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|