C24H32N6O3S — CID 67995258
2-[[6-[4-[2-(dipropylamino)-1,3-thiazol-4-yl]anilino]-5-nitro-2-pyridinyl]amino]butan-1-ol (PubChem CID 67995258) has the molecular formula C24H32N6O3S and a molecular weight of 484.63 g/mol. Its IUPAC name is 2-[[6-[4-[2-(dipropylamino)-1,3-thiazol-4-yl]anilino]-5-nitro-2-pyridinyl]amino]butan-1-ol.
| Compound Name | 2-[[6-[4-[2-(dipropylamino)-1,3-thiazol-4-yl]anilino]-5-nitro-2-pyridinyl]amino]butan-1-ol |
|---|---|
| PubChem CID | 67995258 |
| Molecular Formula | C24H32N6O3S |
| Molecular Weight | 484.63 g/mol |
| Exact Mass | 484.23 |
| IUPAC Name | 2-[[6-[4-[2-(dipropylamino)-1,3-thiazol-4-yl]anilino]-5-nitro-2-pyridinyl]amino]butan-1-ol |
| SMILES | CCCN(CCC)c1nc(-c2ccc(Nc3nc(NC(CC)CO)ccc3[N+](=O)[O-])cc2)cs1 |
| InChI | InChI=1S/C24H32N6O3S/c1-4-13-29(14-5-2)24-27-20(16-34-24)17-7-9-19(10-8-17)26-23-21(30(32)33)11-12-22(28-23)25-18(6-3)15-31/h7-12,16,18,31H,4-6,13-15H2,1-3H3,(H2,25,26,28) |
| InChIKey | ZWSJVXQERAPJKS-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.63 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|