C15H12N4O2S — CID 67997202
N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]-6-nitropyridin-2-amine (PubChem CID 67997202) has the molecular formula C15H12N4O2S and a molecular weight of 312.35 g/mol. Its IUPAC name is N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]-6-nitropyridin-2-amine.
| Compound Name | N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]-6-nitropyridin-2-amine |
|---|---|
| PubChem CID | 67997202 |
| Molecular Formula | C15H12N4O2S |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]-6-nitropyridin-2-amine |
| SMILES | Cc1nc(-c2ccc(Nc3cccc([N+](=O)[O-])n3)cc2)cs1 |
| InChI | InChI=1S/C15H12N4O2S/c1-10-16-13(9-22-10)11-5-7-12(8-6-11)17-14-3-2-4-15(18-14)19(20)21/h2-9H,1H3,(H,17,18) |
| InChIKey | ADRSTEUBPMHPGP-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|