C21H21Cl2N5O4S — CID 23289723
ethyl 1-[4-[(3,4-dichlorophenyl)methylamino]-6-nitrothieno[2,3-d]pyrimidin-2-yl]piperidine-4-carboxylate (PubChem CID 23289723) has the molecular formula C21H21Cl2N5O4S and a molecular weight of 510.40 g/mol. Its IUPAC name is ethyl 1-[4-[(3,4-dichlorophenyl)methylamino]-6-nitrothieno[2,3-d]pyrimidin-2-yl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[4-[(3,4-dichlorophenyl)methylamino]-6-nitrothieno[2,3-d]pyrimidin-2-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 23289723 |
| Molecular Formula | C21H21Cl2N5O4S |
| Molecular Weight | 510.40 g/mol |
| Exact Mass | 509.07 |
| IUPAC Name | ethyl 1-[4-[(3,4-dichlorophenyl)methylamino]-6-nitrothieno[2,3-d]pyrimidin-2-yl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2nc(NCc3ccc(Cl)c(Cl)c3)c3cc([N+](=O)[O-])sc3n2)CC1 |
| InChI | InChI=1S/C21H21Cl2N5O4S/c1-2-32-20(29)13-5-7-27(8-6-13)21-25-18(14-10-17(28(30)31)33-19(14)26-21)24-11-12-3-4-15(22)16(23)9-12/h3-4,9-10,13H,2,5-8,11H2,1H3,(H,24,25,26) |
| InChIKey | MKIIQMHHLCOYAY-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 110.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.40 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|