C21H15ClN4O5S — CID 23289718
4-[4-[(3-chloro-4-methoxyphenyl)methylamino]-6-nitrothieno[2,3-d]pyrimidin-2-yl]benzoic acid (PubChem CID 23289718) has the molecular formula C21H15ClN4O5S and a molecular weight of 470.89 g/mol. Its IUPAC name is 4-[4-[(3-chloro-4-methoxyphenyl)methylamino]-6-nitrothieno[2,3-d]pyrimidin-2-yl]benzoic acid.
| Compound Name | 4-[4-[(3-chloro-4-methoxyphenyl)methylamino]-6-nitrothieno[2,3-d]pyrimidin-2-yl]benzoic acid |
|---|---|
| PubChem CID | 23289718 |
| Molecular Formula | C21H15ClN4O5S |
| Molecular Weight | 470.89 g/mol |
| Exact Mass | 470.05 |
| IUPAC Name | 4-[4-[(3-chloro-4-methoxyphenyl)methylamino]-6-nitrothieno[2,3-d]pyrimidin-2-yl]benzoic acid |
| SMILES | COc1ccc(CNc2nc(-c3ccc(C(=O)O)cc3)nc3sc([N+](=O)[O-])cc23)cc1Cl |
| InChI | InChI=1S/C21H15ClN4O5S/c1-31-16-7-2-11(8-15(16)22)10-23-19-14-9-17(26(29)30)32-20(14)25-18(24-19)12-3-5-13(6-4-12)21(27)28/h2-9H,10H2,1H3,(H,27,28)(H,23,24,25) |
| InChIKey | PPNWGMHJLXLMAH-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 127.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.89 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|