C14H11ClN4O3S — CID 142684119
N-[(3-chloro-4-methoxyphenyl)methyl]-6-nitrothieno[2,3-d]pyrimidin-4-amine (PubChem CID 142684119) has the molecular formula C14H11ClN4O3S and a molecular weight of 350.79 g/mol. Its IUPAC name is N-[(3-chloro-4-methoxyphenyl)methyl]-6-nitrothieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[(3-chloro-4-methoxyphenyl)methyl]-6-nitrothieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 142684119 |
| Molecular Formula | C14H11ClN4O3S |
| Molecular Weight | 350.79 g/mol |
| Exact Mass | 350.02 |
| IUPAC Name | N-[(3-chloro-4-methoxyphenyl)methyl]-6-nitrothieno[2,3-d]pyrimidin-4-amine |
| SMILES | COc1ccc(CNc2ncnc3sc([N+](=O)[O-])cc23)cc1Cl |
| InChI | InChI=1S/C14H11ClN4O3S/c1-22-11-3-2-8(4-10(11)15)6-16-13-9-5-12(19(20)21)23-14(9)18-7-17-13/h2-5,7H,6H2,1H3,(H,16,17,18) |
| InChIKey | IMIKQRZMVORDDK-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 90.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.79 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|