C20H16N4O2S — CID 146096742
N-(2,2-diphenylethyl)-6-nitrothieno[2,3-d]pyrimidin-4-amine (PubChem CID 146096742) has the molecular formula C20H16N4O2S and a molecular weight of 376.44 g/mol. Its IUPAC name is N-(2,2-diphenylethyl)-6-nitrothieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-(2,2-diphenylethyl)-6-nitrothieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 146096742 |
| Molecular Formula | C20H16N4O2S |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | N-(2,2-diphenylethyl)-6-nitrothieno[2,3-d]pyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1cc2c(NCC(c3ccccc3)c3ccccc3)ncnc2s1 |
| InChI | InChI=1S/C20H16N4O2S/c25-24(26)18-11-16-19(22-13-23-20(16)27-18)21-12-17(14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-11,13,17H,12H2,(H,21,22,23) |
| InChIKey | HNNKQCFERXVEIT-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|