C13H8ClN5O4S — CID 18460536
2-chloro-6-nitro-N-[(3-nitrophenyl)methyl]thieno[2,3-d]pyrimidin-4-amine (PubChem CID 18460536) has the molecular formula C13H8ClN5O4S and a molecular weight of 365.76 g/mol. Its IUPAC name is 2-chloro-6-nitro-N-[(3-nitrophenyl)methyl]thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-chloro-6-nitro-N-[(3-nitrophenyl)methyl]thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 18460536 |
| Molecular Formula | C13H8ClN5O4S |
| Molecular Weight | 365.76 g/mol |
| Exact Mass | 365.00 |
| IUPAC Name | 2-chloro-6-nitro-N-[(3-nitrophenyl)methyl]thieno[2,3-d]pyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1cccc(CNc2nc(Cl)nc3sc([N+](=O)[O-])cc23)c1 |
| InChI | InChI=1S/C13H8ClN5O4S/c14-13-16-11(9-5-10(19(22)23)24-12(9)17-13)15-6-7-2-1-3-8(4-7)18(20)21/h1-5H,6H2,(H,15,16,17) |
| InChIKey | DOERLCMYIGQOQN-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 124.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.76 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|