C17H11ClN6O2S — CID 18460093
6-chloro-N-[(3-nitrophenyl)methyl]-2-pyrazin-2-ylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 18460093) has the molecular formula C17H11ClN6O2S and a molecular weight of 398.84 g/mol. Its IUPAC name is 6-chloro-N-[(3-nitrophenyl)methyl]-2-pyrazin-2-ylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 6-chloro-N-[(3-nitrophenyl)methyl]-2-pyrazin-2-ylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 18460093 |
| Molecular Formula | C17H11ClN6O2S |
| Molecular Weight | 398.84 g/mol |
| Exact Mass | 398.04 |
| IUPAC Name | 6-chloro-N-[(3-nitrophenyl)methyl]-2-pyrazin-2-ylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1cccc(CNc2nc(-c3cnccn3)nc3sc(Cl)cc23)c1 |
| InChI | InChI=1S/C17H11ClN6O2S/c18-14-7-12-15(21-8-10-2-1-3-11(6-10)24(25)26)22-16(23-17(12)27-14)13-9-19-4-5-20-13/h1-7,9H,8H2,(H,21,22,23) |
| InChIKey | NHUJJKFKTAAXDO-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 106.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.84 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|