C15H13ClN4O2S — CID 18460434
2-chloro-6-ethyl-N-[(3-nitrophenyl)methyl]thieno[2,3-d]pyrimidin-4-amine (PubChem CID 18460434) has the molecular formula C15H13ClN4O2S and a molecular weight of 348.82 g/mol. Its IUPAC name is 2-chloro-6-ethyl-N-[(3-nitrophenyl)methyl]thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-chloro-6-ethyl-N-[(3-nitrophenyl)methyl]thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 18460434 |
| Molecular Formula | C15H13ClN4O2S |
| Molecular Weight | 348.82 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | 2-chloro-6-ethyl-N-[(3-nitrophenyl)methyl]thieno[2,3-d]pyrimidin-4-amine |
| SMILES | CCc1cc2c(NCc3cccc([N+](=O)[O-])c3)nc(Cl)nc2s1 |
| InChI | InChI=1S/C15H13ClN4O2S/c1-2-11-7-12-13(18-15(16)19-14(12)23-11)17-8-9-4-3-5-10(6-9)20(21)22/h3-7H,2,8H2,1H3,(H,17,18,19) |
| InChIKey | ORHPZUUCTWMFRI-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.82 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|