C21H18N4O2S — CID 91964750
2-benzyl-6-ethyl-N-(3-nitrophenyl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 91964750) has the molecular formula C21H18N4O2S and a molecular weight of 390.47 g/mol. Its IUPAC name is 2-benzyl-6-ethyl-N-(3-nitrophenyl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-benzyl-6-ethyl-N-(3-nitrophenyl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 91964750 |
| Molecular Formula | C21H18N4O2S |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 2-benzyl-6-ethyl-N-(3-nitrophenyl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | CCc1cc2c(Nc3cccc([N+](=O)[O-])c3)nc(Cc3ccccc3)nc2s1 |
| InChI | InChI=1S/C21H18N4O2S/c1-2-17-13-18-20(22-15-9-6-10-16(12-15)25(26)27)23-19(24-21(18)28-17)11-14-7-4-3-5-8-14/h3-10,12-13H,2,11H2,1H3,(H,22,23,24) |
| InChIKey | CZRJEPVSLSPORB-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|