C20H13N5O6S — CID 23289753
4-[6-nitro-4-[(3-nitrophenyl)methylamino]thieno[2,3-d]pyrimidin-2-yl]benzoic acid (PubChem CID 23289753) has the molecular formula C20H13N5O6S and a molecular weight of 451.42 g/mol. Its IUPAC name is 4-[6-nitro-4-[(3-nitrophenyl)methylamino]thieno[2,3-d]pyrimidin-2-yl]benzoic acid.
| Compound Name | 4-[6-nitro-4-[(3-nitrophenyl)methylamino]thieno[2,3-d]pyrimidin-2-yl]benzoic acid |
|---|---|
| PubChem CID | 23289753 |
| Molecular Formula | C20H13N5O6S |
| Molecular Weight | 451.42 g/mol |
| Exact Mass | 451.06 |
| IUPAC Name | 4-[6-nitro-4-[(3-nitrophenyl)methylamino]thieno[2,3-d]pyrimidin-2-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2nc(NCc3cccc([N+](=O)[O-])c3)c3cc([N+](=O)[O-])sc3n2)cc1 |
| InChI | InChI=1S/C20H13N5O6S/c26-20(27)13-6-4-12(5-7-13)17-22-18(15-9-16(25(30)31)32-19(15)23-17)21-10-11-2-1-3-14(8-11)24(28)29/h1-9H,10H2,(H,26,27)(H,21,22,23) |
| InChIKey | CSMDGGSXJXQYCX-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 161.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.42 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|