C20H21N5O4S — CID 23289451
1-[6-methyl-4-[(3-nitrophenyl)methylamino]thieno[2,3-d]pyrimidin-2-yl]piperidine-4-carboxylic acid (PubChem CID 23289451) has the molecular formula C20H21N5O4S and a molecular weight of 427.49 g/mol. Its IUPAC name is 1-[6-methyl-4-[(3-nitrophenyl)methylamino]thieno[2,3-d]pyrimidin-2-yl]piperidine-4-carboxylic acid.
| Compound Name | 1-[6-methyl-4-[(3-nitrophenyl)methylamino]thieno[2,3-d]pyrimidin-2-yl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 23289451 |
| Molecular Formula | C20H21N5O4S |
| Molecular Weight | 427.49 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | 1-[6-methyl-4-[(3-nitrophenyl)methylamino]thieno[2,3-d]pyrimidin-2-yl]piperidine-4-carboxylic acid |
| SMILES | Cc1cc2c(NCc3cccc([N+](=O)[O-])c3)nc(N3CCC(C(=O)O)CC3)nc2s1 |
| InChI | InChI=1S/C20H21N5O4S/c1-12-9-16-17(21-11-13-3-2-4-15(10-13)25(28)29)22-20(23-18(16)30-12)24-7-5-14(6-8-24)19(26)27/h2-4,9-10,14H,5-8,11H2,1H3,(H,26,27)(H,21,22,23) |
| InChIKey | PFMMYLSSNKSZGP-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 121.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.49 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|